About [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate
[(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate (PubChem CID 101096370) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate.
Analyze [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate?
The IUPAC name of [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate (CID 101096370) is [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate.
What is the SMILES notation for [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate?
The canonical SMILES for [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate is CC(=O)OC[C@@H](CC1=CC=CC1)OC(C)=O.
What is the InChIKey of [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate?
The InChIKey is UTQOELKXEDZINE-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H16O4/c1-9(13)15-8-12(16-10(2)14)7-11-5-3-4-6-11/h3-5,12H,6-8H2,1-2H3/t12-/m1/s1.
What are the key properties of [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate?
[(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate has a molecular weight of 224.26 g/mol, XLogP of 1.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-acetyloxy-3-cyclopenta-1,3-dien-1-ylpropyl] acetate is sourced from PubChem (CID 101096370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).