C9H14I2O5 — CID 118586406
[2-acetyloxy-3-(1,1-diiodoethoxy)propyl] acetate (PubChem CID 118586406) has the molecular formula C9H14I2O5 and a molecular weight of 456.01 g/mol. Its IUPAC name is [2-acetyloxy-3-(1,1-diiodoethoxy)propyl] acetate.
| Compound Name | [2-acetyloxy-3-(1,1-diiodoethoxy)propyl] acetate |
|---|---|
| PubChem CID | 118586406 |
| Molecular Formula | C9H14I2O5 |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.89 |
| IUPAC Name | [2-acetyloxy-3-(1,1-diiodoethoxy)propyl] acetate |
| SMILES | CC(=O)OCC(COC(C)(I)I)OC(C)=O |
| InChI | InChI=1S/C9H14I2O5/c1-6(12)14-4-8(16-7(2)13)5-15-9(3,10)11/h8H,4-5H2,1-3H3 |
| InChIKey | VZEBSEFJBZFBES-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|