C30H28NO4+ — CID 11114354
[2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate (PubChem CID 11114354) has the molecular formula C30H28NO4+ and a molecular weight of 466.56 g/mol. Its IUPAC name is [2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate.
| Compound Name | [2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate |
|---|---|
| PubChem CID | 11114354 |
| Molecular Formula | C30H28NO4+ |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [2-acetyloxy-3-(2,4,6-triphenylpyridin-1-ium-1-yl)propyl] acetate |
| SMILES | CC(=O)OCC(C[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C30H28NO4/c1-22(32)34-21-28(35-23(2)33)20-31-29(25-14-8-4-9-15-25)18-27(24-12-6-3-7-13-24)19-30(31)26-16-10-5-11-17-26/h3-19,28H,20-21H2,1-2H3/q+1 |
| InChIKey | HIBWUKKAUIHOTA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|