C23H22NO2+ — CID 3801063
ethyl 4,6-diphenyl-1-prop-2-enylpyridin-1-ium-2-carboxylate (PubChem CID 3801063) has the molecular formula C23H22NO2+ and a molecular weight of 344.43 g/mol. Its IUPAC name is ethyl 4,6-diphenyl-1-prop-2-enylpyridin-1-ium-2-carboxylate.
| Compound Name | ethyl 4,6-diphenyl-1-prop-2-enylpyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 3801063 |
| Molecular Formula | C23H22NO2+ |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | ethyl 4,6-diphenyl-1-prop-2-enylpyridin-1-ium-2-carboxylate |
| SMILES | C=CC[n+]1c(C(=O)OCC)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C23H22NO2/c1-3-15-24-21(19-13-9-6-10-14-19)16-20(18-11-7-5-8-12-18)17-22(24)23(25)26-4-2/h3,5-14,16-17H,1,4,15H2,2H3/q+1 |
| InChIKey | KKLQAXXSCDIXPT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|