C25H21N2+ — CID 3756688
2,4-diphenyl-1-prop-2-enyl-6-pyridin-2-ylpyridin-1-ium (PubChem CID 3756688) has the molecular formula C25H21N2+ and a molecular weight of 349.46 g/mol. Its IUPAC name is 2,4-diphenyl-1-prop-2-enyl-6-pyridin-2-ylpyridin-1-ium.
| Compound Name | 2,4-diphenyl-1-prop-2-enyl-6-pyridin-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 3756688 |
| Molecular Formula | C25H21N2+ |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2,4-diphenyl-1-prop-2-enyl-6-pyridin-2-ylpyridin-1-ium |
| SMILES | C=CC[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccn1 |
| InChI | InChI=1S/C25H21N2/c1-2-17-27-24(21-13-7-4-8-14-21)18-22(20-11-5-3-6-12-20)19-25(27)23-15-9-10-16-26-23/h2-16,18-19H,1,17H2/q+1 |
| InChIKey | LWTKBIUGYOJXBM-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|