C38H27N4O+ — CID 135409880
4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-2-ylphenol (PubChem CID 135409880) has the molecular formula C38H27N4O+ and a molecular weight of 555.66 g/mol. Its IUPAC name is 4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-2-ylphenol.
| Compound Name | 4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-2-ylphenol |
|---|---|
| PubChem CID | 135409880 |
| Molecular Formula | C38H27N4O+ |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-2-ylphenol |
| SMILES | Oc1c(-c2ccccn2)cc(-[n+]2c(-c3ccccc3)cc(-c3ccncc3)cc2-c2ccccc2)cc1-c1ccccn1 |
| InChI | InChI=1S/C38H26N4O/c43-38-32(34-15-7-9-19-40-34)25-31(26-33(38)35-16-8-10-20-41-35)42-36(28-11-3-1-4-12-28)23-30(27-17-21-39-22-18-27)24-37(42)29-13-5-2-6-14-29/h1-26H/p+1 |
| InChIKey | DJSOSEUGNKASEQ-UHFFFAOYSA-O |
| XLogP | 8.19 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|