C38H26N4O — CID 11734364
4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-3-ylphenolate (PubChem CID 11734364) has the molecular formula C38H26N4O and a molecular weight of 554.65 g/mol. Its IUPAC name is 4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-3-ylphenolate.
| Compound Name | 4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-3-ylphenolate |
|---|---|
| PubChem CID | 11734364 |
| Molecular Formula | C38H26N4O |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 4-(2,6-diphenyl-4-pyridin-4-ylpyridin-1-ium-1-yl)-2,6-dipyridin-3-ylphenolate |
| SMILES | [O-]c1c(-c2cccnc2)cc(-[n+]2c(-c3ccccc3)cc(-c3ccncc3)cc2-c2ccccc2)cc1-c1cccnc1 |
| InChI | InChI=1S/C38H26N4O/c43-38-34(30-13-7-17-40-25-30)23-33(24-35(38)31-14-8-18-41-26-31)42-36(28-9-3-1-4-10-28)21-32(27-15-19-39-20-16-27)22-37(42)29-11-5-2-6-12-29/h1-26H |
| InChIKey | KLDWWFPCCVYZBE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 65.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|