C30H26N3+ — CID 131748891
4-[2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridin-1-ium-1-yl]aniline (PubChem CID 131748891) has the molecular formula C30H26N3+ and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-[2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridin-1-ium-1-yl]aniline.
| Compound Name | 4-[2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridin-1-ium-1-yl]aniline |
|---|---|
| PubChem CID | 131748891 |
| Molecular Formula | C30H26N3+ |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-[2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridin-1-ium-1-yl]aniline |
| SMILES | Cc1ccc(-c2cc(-c3ccncc3)cc(-c3ccc(C)cc3)[n+]2-c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C30H26N3/c1-21-3-7-24(8-4-21)29-19-26(23-15-17-32-18-16-23)20-30(25-9-5-22(2)6-10-25)33(29)28-13-11-27(31)12-14-28/h3-20H,31H2,1-2H3/q+1 |
| InChIKey | MMKFOTAPGUPUID-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 42.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|