C42H32NO+ — CID 102227143
1-(4-methoxy-3,5-diphenylphenyl)-2,4,6-triphenylpyridin-1-ium (PubChem CID 102227143) has the molecular formula C42H32NO+ and a molecular weight of 566.72 g/mol. Its IUPAC name is 1-(4-methoxy-3,5-diphenylphenyl)-2,4,6-triphenylpyridin-1-ium.
| Compound Name | 1-(4-methoxy-3,5-diphenylphenyl)-2,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 102227143 |
| Molecular Formula | C42H32NO+ |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | 1-(4-methoxy-3,5-diphenylphenyl)-2,4,6-triphenylpyridin-1-ium |
| SMILES | COc1c(-c2ccccc2)cc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C42H32NO/c1-44-42-38(32-19-9-3-10-20-32)29-37(30-39(42)33-21-11-4-12-22-33)43-40(34-23-13-5-14-24-34)27-36(31-17-7-2-8-18-31)28-41(43)35-25-15-6-16-26-35/h2-30H,1H3/q+1 |
| InChIKey | PZWGFAPMPMPIRD-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|