C25H22NO+ — CID 2326756
4-(4-methoxyphenyl)-1-methyl-2,6-diphenylpyridin-1-ium (PubChem CID 2326756) has the molecular formula C25H22NO+ and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-methyl-2,6-diphenylpyridin-1-ium.
| Compound Name | 4-(4-methoxyphenyl)-1-methyl-2,6-diphenylpyridin-1-ium |
|---|---|
| PubChem CID | 2326756 |
| Molecular Formula | C25H22NO+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-methyl-2,6-diphenylpyridin-1-ium |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[n+](C)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H22NO/c1-26-24(20-9-5-3-6-10-20)17-22(19-13-15-23(27-2)16-14-19)18-25(26)21-11-7-4-8-12-21/h3-18H,1-2H3/q+1 |
| InChIKey | KGGXBIFSXHPETL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|