C25H23N — CID 160651520
carbanide;1-methyl-2,4,6-triphenylpyridin-1-ium (PubChem CID 160651520) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is carbanide;1-methyl-2,4,6-triphenylpyridin-1-ium.
| Compound Name | carbanide;1-methyl-2,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 160651520 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | carbanide;1-methyl-2,4,6-triphenylpyridin-1-ium |
| SMILES | C[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.[CH3-] |
| InChI | InChI=1S/C24H20N.CH3/c1-25-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(25)21-15-9-4-10-16-21;/h2-18H,1H3;1H3/q+1;-1 |
| InChIKey | RKMGKLDVCVARMJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|