C27H24N+ — CID 154719600
1-(1-methylcyclopropyl)-2,4,6-triphenylpyridin-1-ium (PubChem CID 154719600) has the molecular formula C27H24N+ and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-(1-methylcyclopropyl)-2,4,6-triphenylpyridin-1-ium.
| Compound Name | 1-(1-methylcyclopropyl)-2,4,6-triphenylpyridin-1-ium |
|---|---|
| PubChem CID | 154719600 |
| Molecular Formula | C27H24N+ |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-(1-methylcyclopropyl)-2,4,6-triphenylpyridin-1-ium |
| SMILES | CC1([n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C27H24N/c1-27(17-18-27)28-25(22-13-7-3-8-14-22)19-24(21-11-5-2-6-12-21)20-26(28)23-15-9-4-10-16-23/h2-16,19-20H,17-18H2,1H3/q+1 |
| InChIKey | GDPNHTHXABPLKY-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|