About acetylene;1,1'-biphenyl
acetylene;1,1'-biphenyl (PubChem CID 161077140) has the molecular formula C16H14
and a molecular weight of 206.29 g/mol. Its IUPAC name is acetylene;1,1'-biphenyl.
Molecular Properties
| Compound Name | acetylene;1,1'-biphenyl |
| PubChem CID | 161077140 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | acetylene;1,1'-biphenyl |
| SMILES | C#C.C#C.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C2H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2/h1-10H;2*1-2H |
| InChIKey | UFKROTNEORVMNI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1,1'-biphenyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1,1'-biphenyl?
The IUPAC name of acetylene;1,1'-biphenyl (CID 161077140) is acetylene;1,1'-biphenyl.
What is the SMILES notation for acetylene;1,1'-biphenyl?
The canonical SMILES for acetylene;1,1'-biphenyl is C#C.C#C.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of acetylene;1,1'-biphenyl?
The InChIKey is UFKROTNEORVMNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.2C2H2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-2/h1-10H;2*1-2H.
What are the key properties of acetylene;1,1'-biphenyl?
acetylene;1,1'-biphenyl has a molecular weight of 206.29 g/mol, XLogP of 3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1,1'-biphenyl is sourced from PubChem (CID 161077140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).