About potassium;1,1'-biphenyl;carbanide
potassium;1,1'-biphenyl;carbanide (PubChem CID 144916134) has the molecular formula C13H13K
and a molecular weight of 208.34 g/mol. Its IUPAC name is potassium;1,1'-biphenyl;carbanide.
Molecular Properties
| Compound Name | potassium;1,1'-biphenyl;carbanide |
| PubChem CID | 144916134 |
| Molecular Formula | C13H13K |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | potassium;1,1'-biphenyl;carbanide |
| SMILES | [CH3-].[K+].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.CH3.K/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h1-10H;1H3;/q;-1;+1 |
| InChIKey | SXIFSMRAOBIWFL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;1,1'-biphenyl;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1,1'-biphenyl;carbanide?
The IUPAC name of potassium;1,1'-biphenyl;carbanide (CID 144916134) is potassium;1,1'-biphenyl;carbanide.
What is the SMILES notation for potassium;1,1'-biphenyl;carbanide?
The canonical SMILES for potassium;1,1'-biphenyl;carbanide is [CH3-].[K+].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of potassium;1,1'-biphenyl;carbanide?
The InChIKey is SXIFSMRAOBIWFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.CH3.K/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h1-10H;1H3;/q;-1;+1.
What are the key properties of potassium;1,1'-biphenyl;carbanide?
potassium;1,1'-biphenyl;carbanide has a molecular weight of 208.34 g/mol, XLogP of 0.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1,1'-biphenyl;carbanide is sourced from PubChem (CID 144916134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).