C54H50Cl2N2O10 — CID 13185032
4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diperchlorate (PubChem CID 13185032) has the molecular formula C54H50Cl2N2O10 and a molecular weight of 957.90 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diperchlorate.
| Compound Name | 4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diperchlorate |
|---|---|
| PubChem CID | 13185032 |
| Molecular Formula | C54H50Cl2N2O10 |
| Molecular Weight | 957.90 g/mol |
| Exact Mass | 956.28 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-[6-[4-(4-methoxyphenyl)-2,6-diphenylpyridin-1-ium-1-yl]hexyl]-2,6-diphenylpyridin-1-ium diperchlorate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[n+](CCCCCC[n+]3c(-c4ccccc4)cc(-c4ccc(OC)cc4)cc3-c3ccccc3)c(-c3ccccc3)c2)cc1.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C54H50N2O2.2ClHO4/c1-57-49-31-27-41(28-32-49)47-37-51(43-19-9-5-10-20-43)55(52(38-47)44-21-11-6-12-22-44)35-17-3-4-18-36-56-53(45-23-13-7-14-24-45)39-48(42-29-33-50(58-2)34-30-42)40-54(56)46-25-15-8-16-26-46;2*2-1(3,4)5/h5-16,19-34,37-40H,3-4,17-18,35-36H2,1-2H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | DCMCNLQPVQZYPO-UHFFFAOYSA-L |
| XLogP | 3.03 |
| TPSA | 210.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 68 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|