C38H40N4O2S2+2 — CID 3415899
3-[6-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]hexyl]-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine (PubChem CID 3415899) has the molecular formula C38H40N4O2S2+2 and a molecular weight of 648.90 g/mol. Its IUPAC name is 3-[6-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]hexyl]-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine.
| Compound Name | 3-[6-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]hexyl]-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 3415899 |
| Molecular Formula | C38H40N4O2S2+2 |
| Molecular Weight | 648.90 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 3-[6-[2-anilino-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-3-yl]hexyl]-4-(4-methoxyphenyl)-N-phenyl-1,3-thiazol-3-ium-2-amine |
| SMILES | COc1ccc(-c2csc(Nc3ccccc3)[n+]2CCCCCC[n+]2c(-c3ccc(OC)cc3)csc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C38H38N4O2S2/c1-43-33-21-17-29(18-22-33)35-27-45-37(39-31-13-7-5-8-14-31)41(35)25-11-3-4-12-26-42-36(30-19-23-34(44-2)24-20-30)28-46-38(42)40-32-15-9-6-10-16-32/h5-10,13-24,27-28H,3-4,11-12,25-26H2,1-2H3/p+2 |
| InChIKey | UATKZMTXZPBRRK-UHFFFAOYSA-P |
| XLogP | 9.48 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.90 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|