C16H16ClN3OS — CID 23276031
5-(4-methoxyphenyl)-4-methyl-N-phenyl-1,3,4-thiadiazol-4-ium-2-amine chloride (PubChem CID 23276031) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-4-methyl-N-phenyl-1,3,4-thiadiazol-4-ium-2-amine chloride.
| Compound Name | 5-(4-methoxyphenyl)-4-methyl-N-phenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
|---|---|
| PubChem CID | 23276031 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 5-(4-methoxyphenyl)-4-methyl-N-phenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
| SMILES | COc1ccc(-c2sc(Nc3ccccc3)n[n+]2C)cc1.[Cl-] |
| InChI | InChI=1S/C16H16N3OS.ClH/c1-19-15(12-8-10-14(20-2)11-9-12)21-16(18-19)17-13-6-4-3-5-7-13;/h3-11H,1-2H3,(H,17,18);1H/q+1;/p-1 |
| InChIKey | UPDPSRZHQDPUTJ-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|