C20H16ClN3S — CID 10451703
N,4,5-triphenyl-(3,4-15N2)1,3,4-thiadiazol-4-ium-2-(15N)amine chloride (PubChem CID 10451703) has the molecular formula C20H16ClN3S and a molecular weight of 368.87 g/mol. Its IUPAC name is N,4,5-triphenyl-(3,4-15N2)1,3,4-thiadiazol-4-ium-2-(15N)amine chloride.
| Compound Name | N,4,5-triphenyl-(3,4-15N2)1,3,4-thiadiazol-4-ium-2-(15N)amine chloride |
|---|---|
| PubChem CID | 10451703 |
| Molecular Formula | C20H16ClN3S |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N,4,5-triphenyl-(3,4-15N2)1,3,4-thiadiazol-4-ium-2-(15N)amine chloride |
| SMILES | [Cl-].c1ccc([15NH]c2[15n][15n+](-c3ccccc3)c(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C20H16N3S.ClH/c1-4-10-16(11-5-1)19-23(18-14-8-3-9-15-18)22-20(24-19)21-17-12-6-2-7-13-17;/h1-15H,(H,21,22);1H/q+1;/p-1/i21+1,22+1,23+1; |
| InChIKey | PJTBQWQYYUXRQA-AVOHPZLSSA-M |
| XLogP | 1.83 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|