C25H20ClN3O2S — CID 24939245
5-[(1E,3E)-4-(1,3-benzodioxol-5-yl)buta-1,3-dienyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride (PubChem CID 24939245) has the molecular formula C25H20ClN3O2S and a molecular weight of 461.97 g/mol. Its IUPAC name is 5-[(1E,3E)-4-(1,3-benzodioxol-5-yl)buta-1,3-dienyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride.
| Compound Name | 5-[(1E,3E)-4-(1,3-benzodioxol-5-yl)buta-1,3-dienyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
|---|---|
| PubChem CID | 24939245 |
| Molecular Formula | C25H20ClN3O2S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 5-[(1E,3E)-4-(1,3-benzodioxol-5-yl)buta-1,3-dienyl]-N,4-diphenyl-1,3,4-thiadiazol-4-ium-2-amine chloride |
| SMILES | C(/C=C/c1sc(Nc2ccccc2)n[n+]1-c1ccccc1)=C\c1ccc2c(c1)OCO2.[Cl-] |
| InChI | InChI=1S/C25H20N3O2S.ClH/c1-3-10-20(11-4-1)26-25-27-28(21-12-5-2-6-13-21)24(31-25)14-8-7-9-19-15-16-22-23(17-19)30-18-29-22;/h1-17H,18H2,(H,26,27);1H/q+1;/p-1/b9-7+,14-8+; |
| InChIKey | NEUAVBFDOFSYBO-FXNOXHGHSA-M |
| XLogP | 2.62 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|