C22H17N3O4 — CID 126798212
3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-pyridin-2-ylbenzamide (PubChem CID 126798212) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-pyridin-2-ylbenzamide.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 126798212 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-pyridin-2-ylbenzamide |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)Nc1cccc(C(=O)Nc2ccccn2)c1 |
| InChI | InChI=1S/C22H17N3O4/c26-21(10-8-15-7-9-18-19(12-15)29-14-28-18)24-17-5-3-4-16(13-17)22(27)25-20-6-1-2-11-23-20/h1-13H,14H2,(H,24,26)(H,23,25,27) |
| InChIKey | GLOQSHDEJIJTHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|