C20H18N2O6 — CID 55962401
methyl 2-[[3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoyl]amino]acetate (PubChem CID 55962401) has the molecular formula C20H18N2O6 and a molecular weight of 382.37 g/mol. Its IUPAC name is methyl 2-[[3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55962401 |
| Molecular Formula | C20H18N2O6 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl 2-[[3-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(NC(=O)/C=C/c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H18N2O6/c1-26-19(24)11-21-20(25)14-3-2-4-15(10-14)22-18(23)8-6-13-5-7-16-17(9-13)28-12-27-16/h2-10H,11-12H2,1H3,(H,21,25)(H,22,23)/b8-6+ |
| InChIKey | HPDGVJVOQLVUHO-SOFGYWHQSA-N |
| XLogP | 1.97 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|