C23H20N2O4S — CID 55750390
methyl 2-[[3-[3-(5-phenylthiophen-2-yl)prop-2-enoylamino]benzoyl]amino]acetate (PubChem CID 55750390) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 2-[[3-[3-(5-phenylthiophen-2-yl)prop-2-enoylamino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-[3-(5-phenylthiophen-2-yl)prop-2-enoylamino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 55750390 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | methyl 2-[[3-[3-(5-phenylthiophen-2-yl)prop-2-enoylamino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cccc(NC(=O)C=Cc2ccc(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C23H20N2O4S/c1-29-22(27)15-24-23(28)17-8-5-9-18(14-17)25-21(26)13-11-19-10-12-20(30-19)16-6-3-2-4-7-16/h2-14H,15H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | SJMJUWQAOZDGPC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|