C21H19NO3S — CID 7668716
(E)-N-(3,5-dimethoxyphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide (PubChem CID 7668716) has the molecular formula C21H19NO3S and a molecular weight of 365.45 g/mol. Its IUPAC name is (E)-N-(3,5-dimethoxyphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(3,5-dimethoxyphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7668716 |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (E)-N-(3,5-dimethoxyphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(-c3ccccc3)s2)cc(OC)c1 |
| InChI | InChI=1S/C21H19NO3S/c1-24-17-12-16(13-18(14-17)25-2)22-21(23)11-9-19-8-10-20(26-19)15-6-4-3-5-7-15/h3-14H,1-2H3,(H,22,23)/b11-9+ |
| InChIKey | GAHAOKIDBRRRKL-PKNBQFBNSA-N |
| XLogP | 5.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|