C21H19NOS — CID 7667814
(E)-N-(2,4-dimethylphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide (PubChem CID 7667814) has the molecular formula C21H19NOS and a molecular weight of 333.46 g/mol. Its IUPAC name is (E)-N-(2,4-dimethylphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,4-dimethylphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7667814 |
| Molecular Formula | C21H19NOS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (E)-N-(2,4-dimethylphenyl)-3-(5-phenylthiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2ccc(-c3ccccc3)s2)c(C)c1 |
| InChI | InChI=1S/C21H19NOS/c1-15-8-11-19(16(2)14-15)22-21(23)13-10-18-9-12-20(24-18)17-6-4-3-5-7-17/h3-14H,1-2H3,(H,22,23)/b13-10+ |
| InChIKey | LPCGXQVKPDKCRO-JLHYYAGUSA-N |
| XLogP | 5.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|