C14H11Br2NOS — CID 26524126
(E)-N-(2-bromo-4-methylphenyl)-3-(5-bromothiophen-2-yl)prop-2-enamide (PubChem CID 26524126) has the molecular formula C14H11Br2NOS and a molecular weight of 401.12 g/mol. Its IUPAC name is (E)-N-(2-bromo-4-methylphenyl)-3-(5-bromothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromo-4-methylphenyl)-3-(5-bromothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26524126 |
| Molecular Formula | C14H11Br2NOS |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.89 |
| IUPAC Name | (E)-N-(2-bromo-4-methylphenyl)-3-(5-bromothiophen-2-yl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2ccc(Br)s2)c(Br)c1 |
| InChI | InChI=1S/C14H11Br2NOS/c1-9-2-5-12(11(15)8-9)17-14(18)7-4-10-3-6-13(16)19-10/h2-8H,1H3,(H,17,18)/b7-4+ |
| InChIKey | DSHDTVNSJFMMPN-QPJJXVBHSA-N |
| XLogP | 5.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|