C15H14BrNO3S2 — CID 26811859
(E)-3-(5-bromothiophen-2-yl)-N-(2-methyl-5-methylsulfonylphenyl)prop-2-enamide (PubChem CID 26811859) has the molecular formula C15H14BrNO3S2 and a molecular weight of 400.32 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(2-methyl-5-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-methyl-5-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26811859 |
| Molecular Formula | C15H14BrNO3S2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-methyl-5-methylsulfonylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C15H14BrNO3S2/c1-10-3-6-12(22(2,19)20)9-13(10)17-15(18)8-5-11-4-7-14(16)21-11/h3-9H,1-2H3,(H,17,18)/b8-5+ |
| InChIKey | AMZYGLAXSQUOMZ-VMPITWQZSA-N |
| XLogP | 3.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|