C14H11BrClNO3S2 — CID 26860253
(E)-3-(5-bromothiophen-2-yl)-N-(2-chloro-5-methylsulfonylphenyl)prop-2-enamide (PubChem CID 26860253) has the molecular formula C14H11BrClNO3S2 and a molecular weight of 420.74 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(2-chloro-5-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-chloro-5-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26860253 |
| Molecular Formula | C14H11BrClNO3S2 |
| Molecular Weight | 420.74 g/mol |
| Exact Mass | 418.91 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(2-chloro-5-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)/C=C/c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H11BrClNO3S2/c1-22(19,20)10-4-5-11(16)12(8-10)17-14(18)7-3-9-2-6-13(15)21-9/h2-8H,1H3,(H,17,18)/b7-3+ |
| InChIKey | NOPXZLKZLQMXLQ-XVNBXDOJSA-N |
| XLogP | 4.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|