C9H8ClF2NO3S — CID 113218224
N-(2-chloro-5-methylsulfonylphenyl)-2,2-difluoroacetamide (PubChem CID 113218224) has the molecular formula C9H8ClF2NO3S and a molecular weight of 283.68 g/mol. Its IUPAC name is N-(2-chloro-5-methylsulfonylphenyl)-2,2-difluoroacetamide.
| Compound Name | N-(2-chloro-5-methylsulfonylphenyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 113218224 |
| Molecular Formula | C9H8ClF2NO3S |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | N-(2-chloro-5-methylsulfonylphenyl)-2,2-difluoroacetamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C(F)F)c1 |
| InChI | InChI=1S/C9H8ClF2NO3S/c1-17(15,16)5-2-3-6(10)7(4-5)13-9(14)8(11)12/h2-4,8H,1H3,(H,13,14) |
| InChIKey | JDACTISFZZSMDK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |