C10H12ClF2NO2S — CID 102868375
2-chloro-N-(1,1-difluoropropan-2-yl)-5-methylsulfonylaniline (PubChem CID 102868375) has the molecular formula C10H12ClF2NO2S and a molecular weight of 283.73 g/mol. Its IUPAC name is 2-chloro-N-(1,1-difluoropropan-2-yl)-5-methylsulfonylaniline.
| Compound Name | 2-chloro-N-(1,1-difluoropropan-2-yl)-5-methylsulfonylaniline |
|---|---|
| PubChem CID | 102868375 |
| Molecular Formula | C10H12ClF2NO2S |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-N-(1,1-difluoropropan-2-yl)-5-methylsulfonylaniline |
| SMILES | CC(Nc1cc(S(C)(=O)=O)ccc1Cl)C(F)F |
| InChI | InChI=1S/C10H12ClF2NO2S/c1-6(10(12)13)14-9-5-7(17(2,15)16)3-4-8(9)11/h3-6,10,14H,1-2H3 |
| InChIKey | MTTKMIITQXCUIL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |