C10H13F2NO2S — CID 102867799
N-(1,1-difluoropropan-2-yl)-4-methylsulfonylaniline (PubChem CID 102867799) has the molecular formula C10H13F2NO2S and a molecular weight of 249.28 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-4-methylsulfonylaniline.
| Compound Name | N-(1,1-difluoropropan-2-yl)-4-methylsulfonylaniline |
|---|---|
| PubChem CID | 102867799 |
| Molecular Formula | C10H13F2NO2S |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-4-methylsulfonylaniline |
| SMILES | CC(Nc1ccc(S(C)(=O)=O)cc1)C(F)F |
| InChI | InChI=1S/C10H13F2NO2S/c1-7(10(11)12)13-8-3-5-9(6-4-8)16(2,14)15/h3-7,10,13H,1-2H3 |
| InChIKey | WDZDAAMXFYSCNV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |