C16H18FNO3S — CID 99857846
(1S,2R)-1-(4-fluorophenyl)-2-(4-methylsulfonylanilino)propan-1-ol (PubChem CID 99857846) has the molecular formula C16H18FNO3S and a molecular weight of 323.39 g/mol. Its IUPAC name is (1S,2R)-1-(4-fluorophenyl)-2-(4-methylsulfonylanilino)propan-1-ol.
| Compound Name | (1S,2R)-1-(4-fluorophenyl)-2-(4-methylsulfonylanilino)propan-1-ol |
|---|---|
| PubChem CID | 99857846 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | (1S,2R)-1-(4-fluorophenyl)-2-(4-methylsulfonylanilino)propan-1-ol |
| SMILES | C[C@@H](Nc1ccc(S(C)(=O)=O)cc1)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNO3S/c1-11(16(19)12-3-5-13(17)6-4-12)18-14-7-9-15(10-8-14)22(2,20)21/h3-11,16,18-19H,1-2H3/t11-,16-/m1/s1 |
| InChIKey | WJDAREFJUUKLNW-BDJLRTHQSA-N |
| XLogP | 2.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |