C10H12ClF2NO — CID 102869387
2-chloro-N-(1,1-difluoropropan-2-yl)-5-methoxyaniline (PubChem CID 102869387) has the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. Its IUPAC name is 2-chloro-N-(1,1-difluoropropan-2-yl)-5-methoxyaniline.
| Compound Name | 2-chloro-N-(1,1-difluoropropan-2-yl)-5-methoxyaniline |
|---|---|
| PubChem CID | 102869387 |
| Molecular Formula | C10H12ClF2NO |
| Molecular Weight | 235.66 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-chloro-N-(1,1-difluoropropan-2-yl)-5-methoxyaniline |
| SMILES | COc1ccc(Cl)c(NC(C)C(F)F)c1 |
| InChI | InChI=1S/C10H12ClF2NO/c1-6(10(12)13)14-9-5-7(15-2)3-4-8(9)11/h3-6,10,14H,1-2H3 |
| InChIKey | RGRHHPXKBIZNNQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |