C13H21ClN2O2 — CID 103389616
4-N-(2-chloro-5-methoxyphenyl)-5-methoxypentane-1,4-diamine (PubChem CID 103389616) has the molecular formula C13H21ClN2O2 and a molecular weight of 272.78 g/mol. Its IUPAC name is 4-N-(2-chloro-5-methoxyphenyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(2-chloro-5-methoxyphenyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103389616 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-N-(2-chloro-5-methoxyphenyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1cc(OC)ccc1Cl |
| InChI | InChI=1S/C13H21ClN2O2/c1-17-9-10(4-3-7-15)16-13-8-11(18-2)5-6-12(13)14/h5-6,8,10,16H,3-4,7,9,15H2,1-2H3 |
| InChIKey | LOWSGYFTUVKHEX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |