C14H24N2O2 — CID 103389291
5-methoxy-4-N-(2-methoxy-4-methylphenyl)pentane-1,4-diamine (PubChem CID 103389291) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-methoxy-4-N-(2-methoxy-4-methylphenyl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(2-methoxy-4-methylphenyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389291 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 5-methoxy-4-N-(2-methoxy-4-methylphenyl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc(C)cc1OC |
| InChI | InChI=1S/C14H24N2O2/c1-11-6-7-13(14(9-11)18-3)16-12(10-17-2)5-4-8-15/h6-7,9,12,16H,4-5,8,10,15H2,1-3H3 |
| InChIKey | MMDSYXPZGKMYER-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |