C16H28N2O3 — CID 103389254
5-methoxy-4-N-[2-(2-methoxyethoxy)-4-methylphenyl]pentane-1,4-diamine (PubChem CID 103389254) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-methoxy-4-N-[2-(2-methoxyethoxy)-4-methylphenyl]pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-[2-(2-methoxyethoxy)-4-methylphenyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 103389254 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 5-methoxy-4-N-[2-(2-methoxyethoxy)-4-methylphenyl]pentane-1,4-diamine |
| SMILES | COCCOc1cc(C)ccc1NC(CCCN)COC |
| InChI | InChI=1S/C16H28N2O3/c1-13-6-7-15(16(11-13)21-10-9-19-2)18-14(12-20-3)5-4-8-17/h6-7,11,14,18H,4-5,8-10,12,17H2,1-3H3 |
| InChIKey | YWTGJORPKXFJGJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|