C12H17Cl3N2O — CID 103387083
5-methoxy-4-N-(2,4,5-trichlorophenyl)pentane-1,4-diamine (PubChem CID 103387083) has the molecular formula C12H17Cl3N2O and a molecular weight of 311.64 g/mol. Its IUPAC name is 5-methoxy-4-N-(2,4,5-trichlorophenyl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(2,4,5-trichlorophenyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103387083 |
| Molecular Formula | C12H17Cl3N2O |
| Molecular Weight | 311.64 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 5-methoxy-4-N-(2,4,5-trichlorophenyl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl3N2O/c1-18-7-8(3-2-4-16)17-12-6-10(14)9(13)5-11(12)15/h5-6,8,17H,2-4,7,16H2,1H3 |
| InChIKey | XNIMHCSTFLYVLN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|