C14H21ClN2O3 — CID 103388068
methyl 2-[(5-amino-1-methoxypentan-2-yl)amino]-4-chlorobenzoate (PubChem CID 103388068) has the molecular formula C14H21ClN2O3 and a molecular weight of 300.79 g/mol. Its IUPAC name is methyl 2-[(5-amino-1-methoxypentan-2-yl)amino]-4-chlorobenzoate.
| Compound Name | methyl 2-[(5-amino-1-methoxypentan-2-yl)amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 103388068 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 2-[(5-amino-1-methoxypentan-2-yl)amino]-4-chlorobenzoate |
| SMILES | COCC(CCCN)Nc1cc(Cl)ccc1C(=O)OC |
| InChI | InChI=1S/C14H21ClN2O3/c1-19-9-11(4-3-7-16)17-13-8-10(15)5-6-12(13)14(18)20-2/h5-6,8,11,17H,3-4,7,9,16H2,1-2H3 |
| InChIKey | ZBSCWJQZHOCBRR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |