C12H18BrClN2O — CID 103387782
4-N-(4-bromo-2-chlorophenyl)-5-methoxypentane-1,4-diamine (PubChem CID 103387782) has the molecular formula C12H18BrClN2O and a molecular weight of 321.65 g/mol. Its IUPAC name is 4-N-(4-bromo-2-chlorophenyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(4-bromo-2-chlorophenyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103387782 |
| Molecular Formula | C12H18BrClN2O |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-N-(4-bromo-2-chlorophenyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H18BrClN2O/c1-17-8-10(3-2-6-15)16-12-5-4-9(13)7-11(12)14/h4-5,7,10,16H,2-3,6,8,15H2,1H3 |
| InChIKey | YHODKIUUUINOBR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |