C16H21BrN2O — CID 103390438
4-N-(6-bromonaphthalen-2-yl)-5-methoxypentane-1,4-diamine (PubChem CID 103390438) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 4-N-(6-bromonaphthalen-2-yl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(6-bromonaphthalen-2-yl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103390438 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-N-(6-bromonaphthalen-2-yl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C16H21BrN2O/c1-20-11-16(3-2-8-18)19-15-7-5-12-9-14(17)6-4-13(12)10-15/h4-7,9-10,16,19H,2-3,8,11,18H2,1H3 |
| InChIKey | LJGKTLBIBFHMSB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |