C16H29N3O2 — CID 103389195
4-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-methoxypentane-1,4-diamine (PubChem CID 103389195) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103389195 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 4-N-[4-[2-(dimethylamino)ethoxy]phenyl]-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C16H29N3O2/c1-19(2)11-12-21-16-8-6-14(7-9-16)18-15(13-20-3)5-4-10-17/h6-9,15,18H,4-5,10-13,17H2,1-3H3 |
| InChIKey | JLKUPQOUUKDPAZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|