C14H23N3O3 — CID 103388398
2-[4-[(5-amino-1-methoxypentan-2-yl)amino]phenoxy]acetamide (PubChem CID 103388398) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[4-[(5-amino-1-methoxypentan-2-yl)amino]phenoxy]acetamide.
| Compound Name | 2-[4-[(5-amino-1-methoxypentan-2-yl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 103388398 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-[4-[(5-amino-1-methoxypentan-2-yl)amino]phenoxy]acetamide |
| SMILES | COCC(CCCN)Nc1ccc(OCC(N)=O)cc1 |
| InChI | InChI=1S/C14H23N3O3/c1-19-9-12(3-2-8-15)17-11-4-6-13(7-5-11)20-10-14(16)18/h4-7,12,17H,2-3,8-10,15H2,1H3,(H2,16,18) |
| InChIKey | SROMSINWBOXNOI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|