C12H19FN2O — CID 103387248
4-N-(4-fluorophenyl)-5-methoxypentane-1,4-diamine (PubChem CID 103387248) has the molecular formula C12H19FN2O and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103387248 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-N-(4-fluorophenyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C12H19FN2O/c1-16-9-12(3-2-8-14)15-11-6-4-10(13)5-7-11/h4-7,12,15H,2-3,8-9,14H2,1H3 |
| InChIKey | FMPHYGOMVYUNLW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |