C12H17BrF2N2O — CID 103390195
4-N-(4-bromo-2,6-difluorophenyl)-5-methoxypentane-1,4-diamine (PubChem CID 103390195) has the molecular formula C12H17BrF2N2O and a molecular weight of 323.18 g/mol. Its IUPAC name is 4-N-(4-bromo-2,6-difluorophenyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(4-bromo-2,6-difluorophenyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103390195 |
| Molecular Formula | C12H17BrF2N2O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-N-(4-bromo-2,6-difluorophenyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H17BrF2N2O/c1-18-7-9(3-2-4-16)17-12-10(14)5-8(13)6-11(12)15/h5-6,9,17H,2-4,7,16H2,1H3 |
| InChIKey | UVTBKXRRDXOCJT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |