C13H22FN3O3S — CID 103388710
N-[5-[(5-amino-1-methoxypentan-2-yl)amino]-2-fluorophenyl]methanesulfonamide (PubChem CID 103388710) has the molecular formula C13H22FN3O3S and a molecular weight of 319.40 g/mol. Its IUPAC name is N-[5-[(5-amino-1-methoxypentan-2-yl)amino]-2-fluorophenyl]methanesulfonamide.
| Compound Name | N-[5-[(5-amino-1-methoxypentan-2-yl)amino]-2-fluorophenyl]methanesulfonamide |
|---|---|
| PubChem CID | 103388710 |
| Molecular Formula | C13H22FN3O3S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[5-[(5-amino-1-methoxypentan-2-yl)amino]-2-fluorophenyl]methanesulfonamide |
| SMILES | COCC(CCCN)Nc1ccc(F)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H22FN3O3S/c1-20-9-11(4-3-7-15)16-10-5-6-12(14)13(8-10)17-21(2,18)19/h5-6,8,11,16-17H,3-4,7,9,15H2,1-2H3 |
| InChIKey | OMPCDQMJHAGQCC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |