C16H26FN3O — CID 103389279
4-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-methoxypentane-1,4-diamine (PubChem CID 103389279) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 4-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103389279 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-N-(3-fluoro-4-pyrrolidin-1-ylphenyl)-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H26FN3O/c1-21-12-14(5-4-8-18)19-13-6-7-16(15(17)11-13)20-9-2-3-10-20/h6-7,11,14,19H,2-5,8-10,12,18H2,1H3 |
| InChIKey | UKSINLAXEKADFV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|