C13H22N2OS — CID 103387005
5-methoxy-4-N-(3-methylsulfanylphenyl)pentane-1,4-diamine (PubChem CID 103387005) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 5-methoxy-4-N-(3-methylsulfanylphenyl)pentane-1,4-diamine.
| Compound Name | 5-methoxy-4-N-(3-methylsulfanylphenyl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 103387005 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-methoxy-4-N-(3-methylsulfanylphenyl)pentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1cccc(SC)c1 |
| InChI | InChI=1S/C13H22N2OS/c1-16-10-12(6-4-8-14)15-11-5-3-7-13(9-11)17-2/h3,5,7,9,12,15H,4,6,8,10,14H2,1-2H3 |
| InChIKey | WURRLCOCIWKJKH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |