C13H20ClN3O2 — CID 103388414
5-[(5-amino-1-methoxypentan-2-yl)amino]-2-chlorobenzamide (PubChem CID 103388414) has the molecular formula C13H20ClN3O2 and a molecular weight of 285.78 g/mol. Its IUPAC name is 5-[(5-amino-1-methoxypentan-2-yl)amino]-2-chlorobenzamide.
| Compound Name | 5-[(5-amino-1-methoxypentan-2-yl)amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 103388414 |
| Molecular Formula | C13H20ClN3O2 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-[(5-amino-1-methoxypentan-2-yl)amino]-2-chlorobenzamide |
| SMILES | COCC(CCCN)Nc1ccc(Cl)c(C(N)=O)c1 |
| InChI | InChI=1S/C13H20ClN3O2/c1-19-8-10(3-2-6-15)17-9-4-5-12(14)11(7-9)13(16)18/h4-5,7,10,17H,2-3,6,8,15H2,1H3,(H2,16,18) |
| InChIKey | WMCXASUDIRWNMR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |