C14H23N3O3 — CID 103388775
3-[(5-amino-1-methoxypentan-2-yl)amino]-4-methoxybenzamide (PubChem CID 103388775) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[(5-amino-1-methoxypentan-2-yl)amino]-4-methoxybenzamide.
| Compound Name | 3-[(5-amino-1-methoxypentan-2-yl)amino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 103388775 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[(5-amino-1-methoxypentan-2-yl)amino]-4-methoxybenzamide |
| SMILES | COCC(CCCN)Nc1cc(C(N)=O)ccc1OC |
| InChI | InChI=1S/C14H23N3O3/c1-19-9-11(4-3-7-15)17-12-8-10(14(16)18)5-6-13(12)20-2/h5-6,8,11,17H,3-4,7,9,15H2,1-2H3,(H2,16,18) |
| InChIKey | XKLFJBJPABQRKU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |