C15H22N4O — CID 103388549
4-N-[4-(1H-imidazol-5-yl)phenyl]-5-methoxypentane-1,4-diamine (PubChem CID 103388549) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-N-[4-(1H-imidazol-5-yl)phenyl]-5-methoxypentane-1,4-diamine.
| Compound Name | 4-N-[4-(1H-imidazol-5-yl)phenyl]-5-methoxypentane-1,4-diamine |
|---|---|
| PubChem CID | 103388549 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 4-N-[4-(1H-imidazol-5-yl)phenyl]-5-methoxypentane-1,4-diamine |
| SMILES | COCC(CCCN)Nc1ccc(-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C15H22N4O/c1-20-10-14(3-2-8-16)19-13-6-4-12(5-7-13)15-9-17-11-18-15/h4-7,9,11,14,19H,2-3,8,10,16H2,1H3,(H,17,18) |
| InChIKey | HMILXPRQHMZKOU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |