C18H13ClFNO3S2 — CID 9207037
N-(2-chloro-5-methylsulfonylphenyl)-5-(4-fluorophenyl)thiophene-2-carboxamide (PubChem CID 9207037) has the molecular formula C18H13ClFNO3S2 and a molecular weight of 409.89 g/mol. Its IUPAC name is N-(2-chloro-5-methylsulfonylphenyl)-5-(4-fluorophenyl)thiophene-2-carboxamide.
| Compound Name | N-(2-chloro-5-methylsulfonylphenyl)-5-(4-fluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9207037 |
| Molecular Formula | C18H13ClFNO3S2 |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | N-(2-chloro-5-methylsulfonylphenyl)-5-(4-fluorophenyl)thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)c2ccc(-c3ccc(F)cc3)s2)c1 |
| InChI | InChI=1S/C18H13ClFNO3S2/c1-26(23,24)13-6-7-14(19)15(10-13)21-18(22)17-9-8-16(25-17)11-2-4-12(20)5-3-11/h2-10H,1H3,(H,21,22) |
| InChIKey | YYLNMWNXYIMNDL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |